| Name | 3,3-diethoxy-1-propyne |
| Synonyms | 3,3-DIETHOXYPROPYNE TIMTEC-BB SBB008980 3,3-diethoxy-1-propyne 3,3-diethoxyprop-1-yne 3,3-DIETHOXY-1-PROPYNE Propynal diethyl acetal 1-Propyne, 3,3-diethoxy- Propiolaldehyde diethyl acetal PROPIOLALDEHYDE DIETHYL ACETAL Propargylaldehyde diethyl acetal PROPARGYLALDEHYDE DIETHYL ACETAL |
| CAS | 10160-87-9 |
| EINECS | 233-430-4 |
| InChI | InChI=1/C7H12O2/c1-4-7(8-5-2)9-6-3/h1,7H,5-6H2,2-3H3 |
| Molecular Formula | C7H12O2 |
| Molar Mass | 128.17 |
| Density | 0.894g/mLat 25°C(lit.) |
| Boling Point | 138-139.5°C(lit.) |
| Flash Point | 90°F |
| Water Solubility | Slightly soluble in water. |
| Solubility | Chloroform, Methanol (Slightly) |
| Vapor Presure | 8.16mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 0.894 |
| Color | Clear light yellow |
| BRN | 1701566 |
| Storage Condition | 2-8°C |
| Stability | Light Sensitive, Volatile |
| Refractive Index | n20/D 1.412(lit.) |
| MDL | MFCD00009237 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 21 |
| HS Code | 29110000 |
| Hazard Class | 3 |
| Packing Group | III |
| BRN | 1697731 |
| Use | Propionaldehyde diethyl acetal is an effective reactant for the synthesis of alkenyl silane by stereoselective hydrosilylation of alkynes using eosin Y and mercaptan as catalysts. |